C21H25N7O2S — CID 88993908
tert-butyl 4-[6-(cyclopentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]pyrazole-1-carboxylate (PubChem CID 88993908) has the molecular formula C21H25N7O2S and a molecular weight of 439.55 g/mol. Its IUPAC name is tert-butyl 4-[6-(cyclopentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(cyclopentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 88993908 |
| Molecular Formula | C21H25N7O2S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | tert-butyl 4-[6-(cyclopentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2cnc3ccc(NC(=S)NC4CCCC4)nc3n2)cn1 |
| InChI | InChI=1S/C21H25N7O2S/c1-21(2,3)30-20(29)28-12-13(10-23-28)16-11-22-15-8-9-17(26-18(15)25-16)27-19(31)24-14-6-4-5-7-14/h8-12,14H,4-7H2,1-3H3,(H2,24,25,26,27,31) |
| InChIKey | PHJUNXYYAFEUQR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|