C28H40N8O2S — CID 144521313
tert-butyl 4-[2-[[3-amino-2-[6-(cyclopentylcarbamothioylamino)-1,5-naphthyridin-3-yl]prop-2-enylidene]amino]ethyl]piperazine-1-carboxylate (PubChem CID 144521313) has the molecular formula C28H40N8O2S and a molecular weight of 552.75 g/mol. Its IUPAC name is tert-butyl 4-[2-[[3-amino-2-[6-(cyclopentylcarbamothioylamino)-1,5-naphthyridin-3-yl]prop-2-enylidene]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[3-amino-2-[6-(cyclopentylcarbamothioylamino)-1,5-naphthyridin-3-yl]prop-2-enylidene]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 144521313 |
| Molecular Formula | C28H40N8O2S |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | tert-butyl 4-[2-[[3-amino-2-[6-(cyclopentylcarbamothioylamino)-1,5-naphthyridin-3-yl]prop-2-enylidene]amino]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC/N=C/C(=CN)c2cnc3ccc(NC(=S)NC4CCCC4)nc3c2)CC1 |
| InChI | InChI=1S/C28H40N8O2S/c1-28(2,3)38-27(37)36-14-12-35(13-15-36)11-10-30-18-21(17-29)20-16-24-23(31-19-20)8-9-25(33-24)34-26(39)32-22-6-4-5-7-22/h8-9,16-19,22H,4-7,10-15,29H2,1-3H3,(H2,32,33,34,39)/b21-17?,30-18+ |
| InChIKey | YSKQULWDRQFDDQ-PSKKNNDLSA-N |
| XLogP | 3.78 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|