C20H24ClN3O3 — CID 139512502
tert-butyl 4-[(6-chloroquinoline-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 139512502) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is tert-butyl 4-[(6-chloroquinoline-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-chloroquinoline-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139512502 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | tert-butyl 4-[(6-chloroquinoline-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2ccc3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C20H24ClN3O3/c1-20(2,3)27-19(26)24-10-8-15(9-11-24)22-18(25)17-6-4-13-12-14(21)5-7-16(13)23-17/h4-7,12,15H,8-11H2,1-3H3,(H,22,25) |
| InChIKey | AVZCGOMKLWCGMC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |