C21H27ClN4O3 — CID 155741710
tert-butyl N-[[1-[(6-chloroquinoline-2-carbonyl)amino]piperidin-4-yl]methyl]carbamate (PubChem CID 155741710) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is tert-butyl N-[[1-[(6-chloroquinoline-2-carbonyl)amino]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[(6-chloroquinoline-2-carbonyl)amino]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 155741710 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | tert-butyl N-[[1-[(6-chloroquinoline-2-carbonyl)amino]piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(NC(=O)c2ccc3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C21H27ClN4O3/c1-21(2,3)29-20(28)23-13-14-8-10-26(11-9-14)25-19(27)18-6-4-15-12-16(22)5-7-17(15)24-18/h4-7,12,14H,8-11,13H2,1-3H3,(H,23,28)(H,25,27) |
| InChIKey | OCBHQOZWJDLTIQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |