C24H25Cl2FN4O2 — CID 166828255
6-chloro-N-[4-[3-(4-chloro-3-fluorophenoxy)propylamino]piperidin-1-yl]quinoline-2-carboxamide (PubChem CID 166828255) has the molecular formula C24H25Cl2FN4O2 and a molecular weight of 491.39 g/mol. Its IUPAC name is 6-chloro-N-[4-[3-(4-chloro-3-fluorophenoxy)propylamino]piperidin-1-yl]quinoline-2-carboxamide.
| Compound Name | 6-chloro-N-[4-[3-(4-chloro-3-fluorophenoxy)propylamino]piperidin-1-yl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 166828255 |
| Molecular Formula | C24H25Cl2FN4O2 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 6-chloro-N-[4-[3-(4-chloro-3-fluorophenoxy)propylamino]piperidin-1-yl]quinoline-2-carboxamide |
| SMILES | O=C(NN1CCC(NCCCOc2ccc(Cl)c(F)c2)CC1)c1ccc2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C24H25Cl2FN4O2/c25-17-3-7-22-16(14-17)2-6-23(29-22)24(32)30-31-11-8-18(9-12-31)28-10-1-13-33-19-4-5-20(26)21(27)15-19/h2-7,14-15,18,28H,1,8-13H2,(H,30,32) |
| InChIKey | CTYMQQHVZSCDLX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|