C24H24Cl2FN3O2 — CID 138678465
6-chloro-N-[4-[2-(4-chloro-3-fluorophenoxy)ethylamino]cyclohexyl]quinoline-2-carboxamide (PubChem CID 138678465) has the molecular formula C24H24Cl2FN3O2 and a molecular weight of 476.38 g/mol. Its IUPAC name is 6-chloro-N-[4-[2-(4-chloro-3-fluorophenoxy)ethylamino]cyclohexyl]quinoline-2-carboxamide.
| Compound Name | 6-chloro-N-[4-[2-(4-chloro-3-fluorophenoxy)ethylamino]cyclohexyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 138678465 |
| Molecular Formula | C24H24Cl2FN3O2 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 6-chloro-N-[4-[2-(4-chloro-3-fluorophenoxy)ethylamino]cyclohexyl]quinoline-2-carboxamide |
| SMILES | O=C(NC1CCC(NCCOc2ccc(Cl)c(F)c2)CC1)c1ccc2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C24H24Cl2FN3O2/c25-16-2-10-22-15(13-16)1-9-23(30-22)24(31)29-18-5-3-17(4-6-18)28-11-12-32-19-7-8-20(26)21(27)14-19/h1-2,7-10,13-14,17-18,28H,3-6,11-12H2,(H,29,31) |
| InChIKey | DCRPINRDYOWFHM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|