C17H19ClN4O3 — CID 175221856
[1-[(6-chloroquinoline-2-carbonyl)amino]piperidin-4-yl]methyl carbamate (PubChem CID 175221856) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is [1-[(6-chloroquinoline-2-carbonyl)amino]piperidin-4-yl]methyl carbamate.
| Compound Name | [1-[(6-chloroquinoline-2-carbonyl)amino]piperidin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 175221856 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [1-[(6-chloroquinoline-2-carbonyl)amino]piperidin-4-yl]methyl carbamate |
| SMILES | NC(=O)OCC1CCN(NC(=O)c2ccc3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C17H19ClN4O3/c18-13-2-4-14-12(9-13)1-3-15(20-14)16(23)21-22-7-5-11(6-8-22)10-25-17(19)24/h1-4,9,11H,5-8,10H2,(H2,19,24)(H,21,23) |
| InChIKey | RLLULBZGMGDPAS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |