C12H9ClN2O — CID 142528141
6-chloro-N-ethenylquinoline-2-carboxamide (PubChem CID 142528141) has the molecular formula C12H9ClN2O and a molecular weight of 232.67 g/mol. Its IUPAC name is 6-chloro-N-ethenylquinoline-2-carboxamide.
| Compound Name | 6-chloro-N-ethenylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 142528141 |
| Molecular Formula | C12H9ClN2O |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 6-chloro-N-ethenylquinoline-2-carboxamide |
| SMILES | C=CNC(=O)c1ccc2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C12H9ClN2O/c1-2-14-12(16)11-5-3-8-7-9(13)4-6-10(8)15-11/h2-7H,1H2,(H,14,16) |
| InChIKey | BUQPXKLSWLOEKG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |