C21H26ClN3O3 — CID 155391643
tert-butyl 4-[[(6-chloroquinoline-2-carbonyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 155391643) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is tert-butyl 4-[[(6-chloroquinoline-2-carbonyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(6-chloroquinoline-2-carbonyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155391643 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | tert-butyl 4-[[(6-chloroquinoline-2-carbonyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)c2ccc3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-21(2,3)28-20(27)25-10-8-14(9-11-25)13-23-19(26)18-6-4-15-12-16(22)5-7-17(15)24-18/h4-7,12,14H,8-11,13H2,1-3H3,(H,23,26) |
| InChIKey | LFOMFTIQDQAKGA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |