C18H15ClF3N3O4 — CID 155069125
[1-(6-chloroquinoline-2-carbonyl)pyrrolidin-3-yl]methylcarbamoyl 2,2,2-trifluoroacetate (PubChem CID 155069125) has the molecular formula C18H15ClF3N3O4 and a molecular weight of 429.78 g/mol. Its IUPAC name is [1-(6-chloroquinoline-2-carbonyl)pyrrolidin-3-yl]methylcarbamoyl 2,2,2-trifluoroacetate.
| Compound Name | [1-(6-chloroquinoline-2-carbonyl)pyrrolidin-3-yl]methylcarbamoyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155069125 |
| Molecular Formula | C18H15ClF3N3O4 |
| Molecular Weight | 429.78 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | [1-(6-chloroquinoline-2-carbonyl)pyrrolidin-3-yl]methylcarbamoyl 2,2,2-trifluoroacetate |
| SMILES | O=C(NCC1CCN(C(=O)c2ccc3cc(Cl)ccc3n2)C1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H15ClF3N3O4/c19-12-2-4-13-11(7-12)1-3-14(24-13)15(26)25-6-5-10(9-25)8-23-17(28)29-16(27)18(20,21)22/h1-4,7,10H,5-6,8-9H2,(H,23,28) |
| InChIKey | LBLRGUWQHSZWQZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|