C15H18Cl3N3O — CID 119374355
(4-aminopiperidin-1-yl)-(7-chloroquinolin-2-yl)methanone;dihydrochloride (PubChem CID 119374355) has the molecular formula C15H18Cl3N3O and a molecular weight of 362.69 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-(7-chloroquinolin-2-yl)methanone;dihydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-(7-chloroquinolin-2-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119374355 |
| Molecular Formula | C15H18Cl3N3O |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (4-aminopiperidin-1-yl)-(7-chloroquinolin-2-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(C(=O)c2ccc3ccc(Cl)cc3n2)CC1 |
| InChI | InChI=1S/C15H16ClN3O.2ClH/c16-11-3-1-10-2-4-13(18-14(10)9-11)15(20)19-7-5-12(17)6-8-19;;/h1-4,9,12H,5-8,17H2;2*1H |
| InChIKey | RHGYIOUYKUXIIN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |