C16H20Cl3N3O — CID 119649937
(7-chloroquinolin-2-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;dihydrochloride (PubChem CID 119649937) has the molecular formula C16H20Cl3N3O and a molecular weight of 376.72 g/mol. Its IUPAC name is (7-chloroquinolin-2-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;dihydrochloride.
| Compound Name | (7-chloroquinolin-2-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119649937 |
| Molecular Formula | C16H20Cl3N3O |
| Molecular Weight | 376.72 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (7-chloroquinolin-2-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;dihydrochloride |
| SMILES | CNCC1CCCN1C(=O)c1ccc2ccc(Cl)cc2n1.Cl.Cl |
| InChI | InChI=1S/C16H18ClN3O.2ClH/c1-18-10-13-3-2-8-20(13)16(21)14-7-5-11-4-6-12(17)9-15(11)19-14;;/h4-7,9,13,18H,2-3,8,10H2,1H3;2*1H |
| InChIKey | ZWSSHDNAOZOHSX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |