C17H22Cl3N3O — CID 119435711
[2-(1-aminoethyl)piperidin-1-yl]-(7-chloroquinolin-2-yl)methanone;dihydrochloride (PubChem CID 119435711) has the molecular formula C17H22Cl3N3O and a molecular weight of 390.74 g/mol. Its IUPAC name is [2-(1-aminoethyl)piperidin-1-yl]-(7-chloroquinolin-2-yl)methanone;dihydrochloride.
| Compound Name | [2-(1-aminoethyl)piperidin-1-yl]-(7-chloroquinolin-2-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119435711 |
| Molecular Formula | C17H22Cl3N3O |
| Molecular Weight | 390.74 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | [2-(1-aminoethyl)piperidin-1-yl]-(7-chloroquinolin-2-yl)methanone;dihydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)c1ccc2ccc(Cl)cc2n1.Cl.Cl |
| InChI | InChI=1S/C17H20ClN3O.2ClH/c1-11(19)16-4-2-3-9-21(16)17(22)14-8-6-12-5-7-13(18)10-15(12)20-14;;/h5-8,10-11,16H,2-4,9,19H2,1H3;2*1H |
| InChIKey | TYCZCJLSVPXBKT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |