C16H25N5O — CID 124569587
[(2R)-2-[(1S)-1-aminoethyl]piperidin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone (PubChem CID 124569587) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1-aminoethyl]piperidin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone.
| Compound Name | [(2R)-2-[(1S)-1-aminoethyl]piperidin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone |
|---|---|
| PubChem CID | 124569587 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | [(2R)-2-[(1S)-1-aminoethyl]piperidin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone |
| SMILES | C[C@H](N)[C@H]1CCCCN1C(=O)c1ccc(N2CCCC2)nn1 |
| InChI | InChI=1S/C16H25N5O/c1-12(17)14-6-2-3-11-21(14)16(22)13-7-8-15(19-18-13)20-9-4-5-10-20/h7-8,12,14H,2-6,9-11,17H2,1H3/t12-,14+/m0/s1 |
| InChIKey | LRCLOSNTNJIPOO-GXTWGEPZSA-N |
| XLogP | 1.42 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |