C16H21N5O — CID 119436088
[2-(1-aminoethyl)piperidin-1-yl]-(6-pyrazol-1-yl-2-pyridinyl)methanone (PubChem CID 119436088) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is [2-(1-aminoethyl)piperidin-1-yl]-(6-pyrazol-1-yl-2-pyridinyl)methanone.
| Compound Name | [2-(1-aminoethyl)piperidin-1-yl]-(6-pyrazol-1-yl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 119436088 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | [2-(1-aminoethyl)piperidin-1-yl]-(6-pyrazol-1-yl-2-pyridinyl)methanone |
| SMILES | CC(N)C1CCCCN1C(=O)c1cccc(-n2cccn2)n1 |
| InChI | InChI=1S/C16H21N5O/c1-12(17)14-7-2-3-10-20(14)16(22)13-6-4-8-15(19-13)21-11-5-9-18-21/h4-6,8-9,11-12,14H,2-3,7,10,17H2,1H3 |
| InChIKey | HNXZGIACVXOVTE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |