C18H25ClN4O — CID 119436366
1-[2-(1-aminoethyl)piperidin-1-yl]-2-(4-pyrazol-1-ylphenyl)ethanone;hydrochloride (PubChem CID 119436366) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is 1-[2-(1-aminoethyl)piperidin-1-yl]-2-(4-pyrazol-1-ylphenyl)ethanone;hydrochloride.
| Compound Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-2-(4-pyrazol-1-ylphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119436366 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-2-(4-pyrazol-1-ylphenyl)ethanone;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)Cc1ccc(-n2cccn2)cc1.Cl |
| InChI | InChI=1S/C18H24N4O.ClH/c1-14(19)17-5-2-3-11-21(17)18(23)13-15-6-8-16(9-7-15)22-12-4-10-20-22;/h4,6-10,12,14,17H,2-3,5,11,13,19H2,1H3;1H |
| InChIKey | QVLKNWQUBRURNZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |