C15H22ClIN2O — CID 119435228
1-[2-(1-aminoethyl)piperidin-1-yl]-2-(3-iodophenyl)ethanone;hydrochloride (PubChem CID 119435228) has the molecular formula C15H22ClIN2O and a molecular weight of 408.71 g/mol. Its IUPAC name is 1-[2-(1-aminoethyl)piperidin-1-yl]-2-(3-iodophenyl)ethanone;hydrochloride.
| Compound Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-2-(3-iodophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119435228 |
| Molecular Formula | C15H22ClIN2O |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-2-(3-iodophenyl)ethanone;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)Cc1cccc(I)c1.Cl |
| InChI | InChI=1S/C15H21IN2O.ClH/c1-11(17)14-7-2-3-8-18(14)15(19)10-12-5-4-6-13(16)9-12;/h4-6,9,11,14H,2-3,7-8,10,17H2,1H3;1H |
| InChIKey | YECWLYSEUVRJPW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|