C16H20FN5O — CID 125150672
[(2R)-2-[(1R)-1-aminoethyl]piperidin-1-yl]-[1-(4-fluorophenyl)triazol-4-yl]methanone (PubChem CID 125150672) has the molecular formula C16H20FN5O and a molecular weight of 317.37 g/mol. Its IUPAC name is [(2R)-2-[(1R)-1-aminoethyl]piperidin-1-yl]-[1-(4-fluorophenyl)triazol-4-yl]methanone.
| Compound Name | [(2R)-2-[(1R)-1-aminoethyl]piperidin-1-yl]-[1-(4-fluorophenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 125150672 |
| Molecular Formula | C16H20FN5O |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | [(2R)-2-[(1R)-1-aminoethyl]piperidin-1-yl]-[1-(4-fluorophenyl)triazol-4-yl]methanone |
| SMILES | C[C@@H](N)[C@H]1CCCCN1C(=O)c1cn(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C16H20FN5O/c1-11(18)15-4-2-3-9-21(15)16(23)14-10-22(20-19-14)13-7-5-12(17)6-8-13/h5-8,10-11,15H,2-4,9,18H2,1H3/t11-,15-/m1/s1 |
| InChIKey | FOMFSDXZYWMOMU-IAQYHMDHSA-N |
| XLogP | 1.75 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |