C15H28ClN5O — CID 119434773
[2-(1-aminoethyl)piperidin-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone;hydrochloride (PubChem CID 119434773) has the molecular formula C15H28ClN5O and a molecular weight of 329.88 g/mol. Its IUPAC name is [2-(1-aminoethyl)piperidin-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone;hydrochloride.
| Compound Name | [2-(1-aminoethyl)piperidin-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119434773 |
| Molecular Formula | C15H28ClN5O |
| Molecular Weight | 329.88 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | [2-(1-aminoethyl)piperidin-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone;hydrochloride |
| SMILES | CC(C)CCn1cc(C(=O)N2CCCCC2C(C)N)nn1.Cl |
| InChI | InChI=1S/C15H27N5O.ClH/c1-11(2)7-9-19-10-13(17-18-19)15(21)20-8-5-4-6-14(20)12(3)16;/h10-12,14H,4-9,16H2,1-3H3;1H |
| InChIKey | TYOBWWVZSKEREP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.88 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |