C18H30N4O — CID 124860569
[(5aS,9aR)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b]azepin-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone (PubChem CID 124860569) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is [(5aS,9aR)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b]azepin-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone.
| Compound Name | [(5aS,9aR)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b]azepin-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 124860569 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | [(5aS,9aR)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b]azepin-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone |
| SMILES | CC(C)CCn1cc(C(=O)N2CCCC[C@@H]3CCCC[C@H]32)nn1 |
| InChI | InChI=1S/C18H30N4O/c1-14(2)10-12-21-13-16(19-20-21)18(23)22-11-6-5-8-15-7-3-4-9-17(15)22/h13-15,17H,3-12H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | CPPXMNLQIJHNIA-DOTOQJQBSA-N |
| XLogP | 3.51 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |