C17H28N4O — CID 119047862
2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b]azepin-1-yl-(1-tert-butyltriazol-4-yl)methanone (PubChem CID 119047862) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b]azepin-1-yl-(1-tert-butyltriazol-4-yl)methanone.
| Compound Name | 2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b]azepin-1-yl-(1-tert-butyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 119047862 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b]azepin-1-yl-(1-tert-butyltriazol-4-yl)methanone |
| SMILES | CC(C)(C)n1cc(C(=O)N2CCCCC3CCCCC32)nn1 |
| InChI | InChI=1S/C17H28N4O/c1-17(2,3)21-12-14(18-19-21)16(22)20-11-7-6-9-13-8-4-5-10-15(13)20/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | ZJVKXSKLNZURSO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |