C23H26F2N2O — CID 58210908
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-[4-(1,1-difluoroethyl)phenyl]-2-pyridinyl]methanone (PubChem CID 58210908) has the molecular formula C23H26F2N2O and a molecular weight of 384.47 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-[4-(1,1-difluoroethyl)phenyl]-2-pyridinyl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-[4-(1,1-difluoroethyl)phenyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 58210908 |
| Molecular Formula | C23H26F2N2O |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-[4-(1,1-difluoroethyl)phenyl]-2-pyridinyl]methanone |
| SMILES | CC(F)(F)c1ccc(-c2cccc(C(=O)N3CCCC4CCCCC43)n2)cc1 |
| InChI | InChI=1S/C23H26F2N2O/c1-23(24,25)18-13-11-16(12-14-18)19-8-4-9-20(26-19)22(28)27-15-5-7-17-6-2-3-10-21(17)27/h4,8-9,11-14,17,21H,2-3,5-7,10,15H2,1H3 |
| InChIKey | XNWZUUPHJZZJLX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |