C21H22F2N2O — CID 58210834
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-(2,6-difluorophenyl)-2-pyridinyl]methanone (PubChem CID 58210834) has the molecular formula C21H22F2N2O and a molecular weight of 356.42 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-(2,6-difluorophenyl)-2-pyridinyl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-(2,6-difluorophenyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 58210834 |
| Molecular Formula | C21H22F2N2O |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-(2,6-difluorophenyl)-2-pyridinyl]methanone |
| SMILES | O=C(c1cccc(-c2c(F)cccc2F)n1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C21H22F2N2O/c22-15-8-3-9-16(23)20(15)17-10-4-11-18(24-17)21(26)25-13-5-7-14-6-1-2-12-19(14)25/h3-4,8-11,14,19H,1-2,5-7,12-13H2 |
| InChIKey | PUSLCJSQZPYCJX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |