C16H26N4O — CID 97080819
[(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone (PubChem CID 97080819) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is [(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone.
| Compound Name | [(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 97080819 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | [(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[1-(3-methylbutyl)triazol-4-yl]methanone |
| SMILES | CC(C)CCn1cc(C(=O)N2CC[C@H]3CCCC[C@H]32)nn1 |
| InChI | InChI=1S/C16H26N4O/c1-12(2)7-9-19-11-14(17-18-19)16(21)20-10-8-13-5-3-4-6-15(13)20/h11-13,15H,3-10H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | SFHPOVBXOABNLE-UKRRQHHQSA-N |
| XLogP | 2.73 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |