C14H16FN5O — CID 167776575
[1-(4-fluorophenyl)triazol-4-yl]-(2-methylpiperazin-1-yl)methanone (PubChem CID 167776575) has the molecular formula C14H16FN5O and a molecular weight of 289.31 g/mol. Its IUPAC name is [1-(4-fluorophenyl)triazol-4-yl]-(2-methylpiperazin-1-yl)methanone.
| Compound Name | [1-(4-fluorophenyl)triazol-4-yl]-(2-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 167776575 |
| Molecular Formula | C14H16FN5O |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [1-(4-fluorophenyl)triazol-4-yl]-(2-methylpiperazin-1-yl)methanone |
| SMILES | CC1CNCCN1C(=O)c1cn(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C14H16FN5O/c1-10-8-16-6-7-19(10)14(21)13-9-20(18-17-13)12-4-2-11(15)3-5-12/h2-5,9-10,16H,6-8H2,1H3 |
| InChIKey | IMFITUTVGVDTQG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |