C18H23ClFN3O — CID 119472333
[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-(2-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119472333) has the molecular formula C18H23ClFN3O and a molecular weight of 351.85 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-(2-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | [1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-(2-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119472333 |
| Molecular Formula | C18H23ClFN3O |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-(2-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | Cc1cc(C(=O)N2CCNCC2C)c(C)n1-c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C18H22FN3O.ClH/c1-12-10-17(18(23)21-9-8-20-11-13(21)2)14(3)22(12)16-6-4-15(19)5-7-16;/h4-7,10,13,20H,8-9,11H2,1-3H3;1H |
| InChIKey | MCGNWDUXRNRDEN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|