C18H22FN3O — CID 119417104
1,4-diazepan-1-yl-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methanone (PubChem CID 119417104) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 119417104 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1,4-diazepan-1-yl-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCCNCC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN3O/c1-13-12-17(18(23)21-10-3-8-20-9-11-21)14(2)22(13)16-6-4-15(19)5-7-16/h4-7,12,20H,3,8-11H2,1-2H3 |
| InChIKey | MWOKRCIEEJYQHH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|