C20H26FN3O — CID 120820413
(4-amino-3,3-dimethylpiperidin-1-yl)-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methanone (PubChem CID 120820413) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is (4-amino-3,3-dimethylpiperidin-1-yl)-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methanone.
| Compound Name | (4-amino-3,3-dimethylpiperidin-1-yl)-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 120820413 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (4-amino-3,3-dimethylpiperidin-1-yl)-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC(N)C(C)(C)C2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FN3O/c1-13-11-17(14(2)24(13)16-7-5-15(21)6-8-16)19(25)23-10-9-18(22)20(3,4)12-23/h5-8,11,18H,9-10,12,22H2,1-4H3 |
| InChIKey | DCBYUTQMQMIAFY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|