C20H27Cl2N3O — CID 120819968
(4-amino-3,3-dimethylpiperidin-1-yl)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methanone;hydrochloride (PubChem CID 120819968) has the molecular formula C20H27Cl2N3O and a molecular weight of 396.36 g/mol. Its IUPAC name is (4-amino-3,3-dimethylpiperidin-1-yl)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methanone;hydrochloride.
| Compound Name | (4-amino-3,3-dimethylpiperidin-1-yl)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120819968 |
| Molecular Formula | C20H27Cl2N3O |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (4-amino-3,3-dimethylpiperidin-1-yl)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methanone;hydrochloride |
| SMILES | Cc1cc(C(=O)N2CCC(N)C(C)(C)C2)c(C)n1-c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C20H26ClN3O.ClH/c1-13-10-17(14(2)24(13)16-7-5-6-15(21)11-16)19(25)23-9-8-18(22)20(3,4)12-23;/h5-7,10-11,18H,8-9,12,22H2,1-4H3;1H |
| InChIKey | DTUGTCOYEQNZTI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|