C18H19ClN2O3 — CID 119354933
1-[1-(3-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 119354933) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[1-(3-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119354933 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[1-(3-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)N2CCC(C(=O)O)C2)c(C)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-11-8-16(17(22)20-7-6-13(10-20)18(23)24)12(2)21(11)15-5-3-4-14(19)9-15/h3-5,8-9,13H,6-7,10H2,1-2H3,(H,23,24) |
| InChIKey | IFOKSTHZPXNVDO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|