C18H22N2O2 — CID 110883810
(2,5-dimethyl-1-phenylpyrrol-3-yl)-(3-hydroxypiperidin-1-yl)methanone (PubChem CID 110883810) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (2,5-dimethyl-1-phenylpyrrol-3-yl)-(3-hydroxypiperidin-1-yl)methanone.
| Compound Name | (2,5-dimethyl-1-phenylpyrrol-3-yl)-(3-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 110883810 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2,5-dimethyl-1-phenylpyrrol-3-yl)-(3-hydroxypiperidin-1-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCC(O)C2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H22N2O2/c1-13-11-17(18(22)19-10-6-9-16(21)12-19)14(2)20(13)15-7-4-3-5-8-15/h3-5,7-8,11,16,21H,6,9-10,12H2,1-2H3 |
| InChIKey | DJQZSRRDSCVMHJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|