C21H30ClN3O2 — CID 119595513
[3-(1-aminoethyl)piperidin-1-yl]-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanone;hydrochloride (PubChem CID 119595513) has the molecular formula C21H30ClN3O2 and a molecular weight of 391.94 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanone;hydrochloride.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119595513 |
| Molecular Formula | C21H30ClN3O2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanone;hydrochloride |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)N3CCCC(C(C)N)C3)c2C)cc1.Cl |
| InChI | InChI=1S/C21H29N3O2.ClH/c1-14-12-20(21(25)23-11-5-6-17(13-23)15(2)22)16(3)24(14)18-7-9-19(26-4)10-8-18;/h7-10,12,15,17H,5-6,11,13,22H2,1-4H3;1H |
| InChIKey | GCZJSOKHBJVCAH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|