C19H25N3O2 — CID 119633449
[2-(aminomethyl)pyrrolidin-1-yl]-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanone (PubChem CID 119633449) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanone.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 119633449 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanone |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)N3CCCC3CN)c2C)cc1 |
| InChI | InChI=1S/C19H25N3O2/c1-13-11-18(19(23)21-10-4-5-16(21)12-20)14(2)22(13)15-6-8-17(24-3)9-7-15/h6-9,11,16H,4-5,10,12,20H2,1-3H3 |
| InChIKey | HKHULCKTRVKHSP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|