C19H22N2O4 — CID 119251590
1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119251590) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251590 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)N2CCC(O)(C(=O)O)CC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C19H22N2O4/c1-13-12-16(14(2)21(13)15-6-4-3-5-7-15)17(22)20-10-8-19(25,9-11-20)18(23)24/h3-7,12,25H,8-11H2,1-2H3,(H,23,24) |
| InChIKey | OJGWAVXHQBOLMI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|