C20H26N2O — CID 46798353
(2,5-dimethyl-1-phenylpyrrol-3-yl)-(3,5-dimethylpiperidin-1-yl)methanone (PubChem CID 46798353) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (2,5-dimethyl-1-phenylpyrrol-3-yl)-(3,5-dimethylpiperidin-1-yl)methanone.
| Compound Name | (2,5-dimethyl-1-phenylpyrrol-3-yl)-(3,5-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 46798353 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (2,5-dimethyl-1-phenylpyrrol-3-yl)-(3,5-dimethylpiperidin-1-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CC(C)CC(C)C2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-14-10-15(2)13-21(12-14)20(23)19-11-16(3)22(17(19)4)18-8-6-5-7-9-18/h5-9,11,14-15H,10,12-13H2,1-4H3 |
| InChIKey | IGKQFYRSBIDVSZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|