C21H24N2O3 — CID 120978795
(3R,4R)-4-cyclopropyl-1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 120978795) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (3R,4R)-4-cyclopropyl-1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-cyclopropyl-1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120978795 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3R,4R)-4-cyclopropyl-1-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)N2C[C@H](C(=O)O)[C@@H](C3CC3)C2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H24N2O3/c1-13-10-17(14(2)23(13)16-6-4-3-5-7-16)20(24)22-11-18(15-8-9-15)19(12-22)21(25)26/h3-7,10,15,18-19H,8-9,11-12H2,1-2H3,(H,25,26)/t18-,19+/m1/s1 |
| InChIKey | LPFUPAVUWDDUPI-MOPGFXCFSA-N |
| XLogP | 3.28 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|