C19H22N2O3 — CID 120978142
(3R,4R)-4-cyclopropyl-1-(2,3-dimethyl-1H-indole-7-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 120978142) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (3R,4R)-4-cyclopropyl-1-(2,3-dimethyl-1H-indole-7-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-cyclopropyl-1-(2,3-dimethyl-1H-indole-7-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120978142 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (3R,4R)-4-cyclopropyl-1-(2,3-dimethyl-1H-indole-7-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1[nH]c2c(C(=O)N3C[C@H](C(=O)O)[C@@H](C4CC4)C3)cccc2c1C |
| InChI | InChI=1S/C19H22N2O3/c1-10-11(2)20-17-13(10)4-3-5-14(17)18(22)21-8-15(12-6-7-12)16(9-21)19(23)24/h3-5,12,15-16,20H,6-9H2,1-2H3,(H,23,24)/t15-,16+/m1/s1 |
| InChIKey | CZYHLPXFWLOJBW-CVEARBPZSA-N |
| XLogP | 2.97 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|