C20H26N2O2 — CID 71909803
(2,3-dimethyl-1H-indol-7-yl)-[3-(oxan-4-yl)pyrrolidin-1-yl]methanone (PubChem CID 71909803) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-7-yl)-[3-(oxan-4-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-7-yl)-[3-(oxan-4-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 71909803 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2,3-dimethyl-1H-indol-7-yl)-[3-(oxan-4-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1[nH]c2c(C(=O)N3CCC(C4CCOCC4)C3)cccc2c1C |
| InChI | InChI=1S/C20H26N2O2/c1-13-14(2)21-19-17(13)4-3-5-18(19)20(23)22-9-6-16(12-22)15-7-10-24-11-8-15/h3-5,15-16,21H,6-12H2,1-2H3 |
| InChIKey | PQSLRHCTQZYMQA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|