C20H27N3O2 — CID 94365647
(3S)-1-(2,3-dimethyl-1H-indole-7-carbonyl)-N-propylpiperidine-3-carboxamide (PubChem CID 94365647) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (3S)-1-(2,3-dimethyl-1H-indole-7-carbonyl)-N-propylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(2,3-dimethyl-1H-indole-7-carbonyl)-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94365647 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3S)-1-(2,3-dimethyl-1H-indole-7-carbonyl)-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)[C@H]1CCCN(C(=O)c2cccc3c(C)c(C)[nH]c23)C1 |
| InChI | InChI=1S/C20H27N3O2/c1-4-10-21-19(24)15-7-6-11-23(12-15)20(25)17-9-5-8-16-13(2)14(3)22-18(16)17/h5,8-9,15,22H,4,6-7,10-12H2,1-3H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | RRKXQZHMPRRXEG-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|