C23H30N2O2 — CID 74627325
N-hexyl-1-(naphthalene-1-carbonyl)piperidine-3-carboxamide (PubChem CID 74627325) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-hexyl-1-(naphthalene-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-hexyl-1-(naphthalene-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 74627325 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-hexyl-1-(naphthalene-1-carbonyl)piperidine-3-carboxamide |
| SMILES | CCCCCCNC(=O)C1CCCN(C(=O)c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C23H30N2O2/c1-2-3-4-7-15-24-22(26)19-12-9-16-25(17-19)23(27)21-14-8-11-18-10-5-6-13-20(18)21/h5-6,8,10-11,13-14,19H,2-4,7,9,12,15-17H2,1H3,(H,24,26) |
| InChIKey | YQXAQDVCLDFEJY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|