C27H35N3O4 — CID 55953689
N-(3-methoxypropyl)-1-[1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]piperidine-4-carboxamide (PubChem CID 55953689) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-[1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1-[1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55953689 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-(3-methoxypropyl)-1-[1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(C(=O)C2CCCN(C(=O)c3cccc4ccccc34)C2)CC1 |
| InChI | InChI=1S/C27H35N3O4/c1-34-18-6-14-28-25(31)21-12-16-29(17-13-21)26(32)22-9-5-15-30(19-22)27(33)24-11-4-8-20-7-2-3-10-23(20)24/h2-4,7-8,10-11,21-22H,5-6,9,12-19H2,1H3,(H,28,31) |
| InChIKey | SDZVXAKIJIEZSI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|