C29H32N2O3 — CID 51927556
[(3R)-1-(naphthalene-1-carbonyl)piperidin-3-yl]-(4-phenylmethoxypiperidin-1-yl)methanone (PubChem CID 51927556) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is [(3R)-1-(naphthalene-1-carbonyl)piperidin-3-yl]-(4-phenylmethoxypiperidin-1-yl)methanone.
| Compound Name | [(3R)-1-(naphthalene-1-carbonyl)piperidin-3-yl]-(4-phenylmethoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 51927556 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | [(3R)-1-(naphthalene-1-carbonyl)piperidin-3-yl]-(4-phenylmethoxypiperidin-1-yl)methanone |
| SMILES | O=C(c1cccc2ccccc12)N1CCC[C@@H](C(=O)N2CCC(OCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C29H32N2O3/c32-28(30-18-15-25(16-19-30)34-21-22-8-2-1-3-9-22)24-12-7-17-31(20-24)29(33)27-14-6-11-23-10-4-5-13-26(23)27/h1-6,8-11,13-14,24-25H,7,12,15-21H2/t24-/m1/s1 |
| InChIKey | KPNXEEXXJZMLKQ-XMMPIXPASA-N |
| XLogP | 4.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |