C28H29N3O4 — CID 154858593
phenyl 4-[1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]piperazine-1-carboxylate (PubChem CID 154858593) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is phenyl 4-[1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | phenyl 4-[1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154858593 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | phenyl 4-[1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]piperazine-1-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCN(C(=O)C2CCCN(C(=O)c3cccc4ccccc34)C2)CC1 |
| InChI | InChI=1S/C28H29N3O4/c32-26(29-16-18-30(19-17-29)28(34)35-23-11-2-1-3-12-23)22-10-7-15-31(20-22)27(33)25-14-6-9-21-8-4-5-13-24(21)25/h1-6,8-9,11-14,22H,7,10,15-20H2 |
| InChIKey | OYVSEVPUTJFCPW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |