C27H28N2O4 — CID 97253196
methyl 3-[2-[[(3S)-1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]amino]ethyl]benzoate (PubChem CID 97253196) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is methyl 3-[2-[[(3S)-1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]amino]ethyl]benzoate.
| Compound Name | methyl 3-[2-[[(3S)-1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 97253196 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | methyl 3-[2-[[(3S)-1-(naphthalene-1-carbonyl)piperidine-3-carbonyl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1cccc(CCNC(=O)[C@H]2CCCN(C(=O)c3cccc4ccccc34)C2)c1 |
| InChI | InChI=1S/C27H28N2O4/c1-33-27(32)21-10-4-7-19(17-21)14-15-28-25(30)22-11-6-16-29(18-22)26(31)24-13-5-9-20-8-2-3-12-23(20)24/h2-5,7-10,12-13,17,22H,6,11,14-16,18H2,1H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | ZEBJBDWFBTYSFM-QFIPXVFZSA-N |
| XLogP | 3.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |