C23H27ClN2O4 — CID 94082313
(3S)-1-(2-chlorobenzoyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-3-carboxamide (PubChem CID 94082313) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is (3S)-1-(2-chlorobenzoyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2-chlorobenzoyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94082313 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (3S)-1-(2-chlorobenzoyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)[C@H]2CCCN(C(=O)c3ccccc3Cl)C2)cc1OC |
| InChI | InChI=1S/C23H27ClN2O4/c1-29-20-10-9-16(14-21(20)30-2)11-12-25-22(27)17-6-5-13-26(15-17)23(28)18-7-3-4-8-19(18)24/h3-4,7-10,14,17H,5-6,11-13,15H2,1-2H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | GIONSPLRBBLOBR-KRWDZBQOSA-N |
| XLogP | 3.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |