C18H23N3O — CID 74233521
[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(2,3-dimethyl-1H-indol-7-yl)methanone (PubChem CID 74233521) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(2,3-dimethyl-1H-indol-7-yl)methanone.
| Compound Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(2,3-dimethyl-1H-indol-7-yl)methanone |
|---|---|
| PubChem CID | 74233521 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(2,3-dimethyl-1H-indol-7-yl)methanone |
| SMILES | Cc1[nH]c2c(C(=O)N3C[C@@H]4CCCN[C@@H]4C3)cccc2c1C |
| InChI | InChI=1S/C18H23N3O/c1-11-12(2)20-17-14(11)6-3-7-15(17)18(22)21-9-13-5-4-8-19-16(13)10-21/h3,6-7,13,16,19-20H,4-5,8-10H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | DCIUXHDXMHVCHA-XJKSGUPXSA-N |
| XLogP | 2.61 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|