C15H20N2O — CID 102679912
[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(4-methylphenyl)methanone (PubChem CID 102679912) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(4-methylphenyl)methanone.
| Compound Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 102679912 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@@H]3CCCN[C@@H]3C2)cc1 |
| InChI | InChI=1S/C15H20N2O/c1-11-4-6-12(7-5-11)15(18)17-9-13-3-2-8-16-14(13)10-17/h4-7,13-14,16H,2-3,8-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | OCDWQOMZQMLUPI-UONOGXRCSA-N |
| XLogP | 1.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |