C15H20N2O2 — CID 102680439
1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(2-hydroxy-5-methylphenyl)methanone (PubChem CID 102680439) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(2-hydroxy-5-methylphenyl)methanone.
| Compound Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(2-hydroxy-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 102680439 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(2-hydroxy-5-methylphenyl)methanone |
| SMILES | Cc1ccc(O)c(C(=O)N2CC3CCCNC3C2)c1 |
| InChI | InChI=1S/C15H20N2O2/c1-10-4-5-14(18)12(7-10)15(19)17-8-11-3-2-6-16-13(11)9-17/h4-5,7,11,13,16,18H,2-3,6,8-9H2,1H3 |
| InChIKey | AUIUIMWLPMPQBR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |