C18H21N3O3 — CID 94371459
(2S)-4-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)morpholine-2-carboxamide (PubChem CID 94371459) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2S)-4-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)morpholine-2-carboxamide.
| Compound Name | (2S)-4-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 94371459 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2S)-4-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)morpholine-2-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCO[C@H](C(N)=O)C2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-10-15(13(2)21(12)14-6-4-3-5-7-14)18(23)20-8-9-24-16(11-20)17(19)22/h3-7,10,16H,8-9,11H2,1-2H3,(H2,19,22)/t16-/m0/s1 |
| InChIKey | TZQWWNAEEDQUBK-INIZCTEOSA-N |
| XLogP | 1.42 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|