C20H24N2O4 — CID 120527598
2-[4-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]morpholin-2-yl]acetic acid (PubChem CID 120527598) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[4-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 120527598 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[4-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]morpholin-2-yl]acetic acid |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)N2CCOC(CC(=O)O)C2)c1C |
| InChI | InChI=1S/C20H24N2O4/c1-13-6-4-5-7-18(13)22-14(2)10-17(15(22)3)20(25)21-8-9-26-16(12-21)11-19(23)24/h4-7,10,16H,8-9,11-12H2,1-3H3,(H,23,24) |
| InChIKey | XQGATCWTSOWFHP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|